C17H27ClO3SSi — CID 138975548
ethyl 2-[tert-butyl(dimethyl)silyl]oxy-3-chloro-3-phenylsulfanylpropanoate (PubChem CID 138975548) has the molecular formula C17H27ClO3SSi and a molecular weight of 375.01 g/mol. Its IUPAC name is ethyl 2-[tert-butyl(dimethyl)silyl]oxy-3-chloro-3-phenylsulfanylpropanoate.
| Compound Name | ethyl 2-[tert-butyl(dimethyl)silyl]oxy-3-chloro-3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 138975548 |
| Molecular Formula | C17H27ClO3SSi |
| Molecular Weight | 375.01 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | ethyl 2-[tert-butyl(dimethyl)silyl]oxy-3-chloro-3-phenylsulfanylpropanoate |
| SMILES | CCOC(=O)C(O[Si](C)(C)C(C)(C)C)C(Cl)Sc1ccccc1 |
| InChI | InChI=1S/C17H27ClO3SSi/c1-7-20-16(19)14(21-23(5,6)17(2,3)4)15(18)22-13-11-9-8-10-12-13/h8-12,14-15H,7H2,1-6H3 |
| InChIKey | VKXDJSNRIRJUOR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.01 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|