C20H33NO5SSi — CID 70181169
(2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylsulfanylpropanoic acid (PubChem CID 70181169) has the molecular formula C20H33NO5SSi and a molecular weight of 427.64 g/mol. Its IUPAC name is (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylsulfanylpropanoic acid.
| Compound Name | (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 70181169 |
| Molecular Formula | C20H33NO5SSi |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylsulfanylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Sc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H33NO5SSi/c1-19(2,3)25-18(24)21-16(27-14-12-10-9-11-13-14)15(17(22)23)26-28(7,8)20(4,5)6/h9-13,15-16H,1-8H3,(H,21,24)(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | QBQOULJQTBLUHG-HOTGVXAUSA-N |
| XLogP | 5.10 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|