C20H35NO3Si — CID 11314550
tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]carbamate (PubChem CID 11314550) has the molecular formula C20H35NO3Si and a molecular weight of 365.59 g/mol. Its IUPAC name is tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11314550 |
| Molecular Formula | C20H35NO3Si |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO[Si](C)(C)C(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C20H35NO3Si/c1-19(2,3)24-18(22)21-17(14-16-12-10-9-11-13-16)15-23-25(7,8)20(4,5)6/h9-13,17H,14-15H2,1-8H3,(H,21,22) |
| InChIKey | QBMRSKHHBWAVDB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|