C16H27NO2Si — CID 22399693
tert-butyl N-(2-phenyl-1-trimethylsilylethyl)carbamate (PubChem CID 22399693) has the molecular formula C16H27NO2Si and a molecular weight of 293.48 g/mol. Its IUPAC name is tert-butyl N-(2-phenyl-1-trimethylsilylethyl)carbamate.
| Compound Name | tert-butyl N-(2-phenyl-1-trimethylsilylethyl)carbamate |
|---|---|
| PubChem CID | 22399693 |
| Molecular Formula | C16H27NO2Si |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | tert-butyl N-(2-phenyl-1-trimethylsilylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H27NO2Si/c1-16(2,3)19-15(18)17-14(20(4,5)6)12-13-10-8-7-9-11-13/h7-11,14H,12H2,1-6H3,(H,17,18) |
| InChIKey | HLERLJOBAPXCFP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|