C15H31NO5Si — CID 87219695
(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 87219695) has the molecular formula C15H31NO5Si and a molecular weight of 333.50 g/mol. Its IUPAC name is (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 87219695 |
| Molecular Formula | C15H31NO5Si |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO[Si](C)(C)C(C)(C)C)CC(=O)O |
| InChI | InChI=1S/C15H31NO5Si/c1-14(2,3)21-13(19)16-11(9-12(17)18)10-20-22(7,8)15(4,5)6/h11H,9-10H2,1-8H3,(H,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | DTQBFIWEMSHLLQ-NSHDSACASA-N |
| XLogP | 3.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|