C17H35NO4Si — CID 10958910
tert-butyl N-[(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpent-4-en-2-yl]carbamate (PubChem CID 10958910) has the molecular formula C17H35NO4Si and a molecular weight of 345.56 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 10958910 |
| Molecular Formula | C17H35NO4Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl N-[(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpent-4-en-2-yl]carbamate |
| SMILES | C=C(C)[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H35NO4Si/c1-12(2)14(19)13(18-15(20)22-16(3,4)5)11-21-23(9,10)17(6,7)8/h13-14,19H,1,11H2,2-10H3,(H,18,20)/t13-,14-/m1/s1 |
| InChIKey | GCYIBVVXUFYNSE-ZIAGYGMSSA-N |
| XLogP | 3.84 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|