C18H38INO5Si — CID 87647512
tert-butyl N-[(1R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethoxy-1-(2-iodoethoxy)propan-2-yl]carbamate (PubChem CID 87647512) has the molecular formula C18H38INO5Si and a molecular weight of 503.49 g/mol. Its IUPAC name is tert-butyl N-[(1R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethoxy-1-(2-iodoethoxy)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethoxy-1-(2-iodoethoxy)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 87647512 |
| Molecular Formula | C18H38INO5Si |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | tert-butyl N-[(1R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethoxy-1-(2-iodoethoxy)propan-2-yl]carbamate |
| SMILES | CCOC(OCCI)C(CO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H38INO5Si/c1-10-22-15(23-12-11-19)14(20-16(21)25-17(2,3)4)13-24-26(8,9)18(5,6)7/h14-15H,10-13H2,1-9H3,(H,20,21) |
| InChIKey | SFAFEHDJPBIEMB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|