C22H47NO6SSi — CID 58714864
[(2R,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]octan-4-yl] methanesulfonate (PubChem CID 58714864) has the molecular formula C22H47NO6SSi and a molecular weight of 481.77 g/mol. Its IUPAC name is [(2R,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]octan-4-yl] methanesulfonate.
| Compound Name | [(2R,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]octan-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 58714864 |
| Molecular Formula | C22H47NO6SSi |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | [(2R,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]octan-4-yl] methanesulfonate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[C@@H](C[C@@H](C)CO[Si](C)(C)C(C)(C)C)OS(C)(=O)=O |
| InChI | InChI=1S/C22H47NO6SSi/c1-16(2)13-18(23-20(24)28-21(4,5)6)19(29-30(10,25)26)14-17(3)15-27-31(11,12)22(7,8)9/h16-19H,13-15H2,1-12H3,(H,23,24)/t17-,18+,19-/m1/s1 |
| InChIKey | RXKVGIRNRJJLRW-CEXWTWQISA-N |
| XLogP | 5.32 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|