C19H39NO5Si — CID 88701729
(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid (PubChem CID 88701729) has the molecular formula C19H39NO5Si and a molecular weight of 389.61 g/mol. Its IUPAC name is (3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid.
| Compound Name | (3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
|---|---|
| PubChem CID | 88701729 |
| Molecular Formula | C19H39NO5Si |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | (3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39NO5Si/c1-13(2)11-14(20-17(23)24-18(3,4)5)15(12-16(21)22)25-26(9,10)19(6,7)8/h13-15H,11-12H2,1-10H3,(H,20,23)(H,21,22)/t14-,15-/m0/s1 |
| InChIKey | ZFQBDDVTBNXQCU-GJZGRUSLSA-N |
| XLogP | 4.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|