C44H62N2O6SSi — CID 71573929
prop-2-enyl (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]heptanoate (PubChem CID 71573929) has the molecular formula C44H62N2O6SSi and a molecular weight of 775.14 g/mol. Its IUPAC name is prop-2-enyl (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]heptanoate.
| Compound Name | prop-2-enyl (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]heptanoate |
|---|---|
| PubChem CID | 71573929 |
| Molecular Formula | C44H62N2O6SSi |
| Molecular Weight | 775.14 g/mol |
| Exact Mass | 774.41 |
| IUPAC Name | prop-2-enyl (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]heptanoate |
| SMILES | C=CCOC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CC(C)C)NC(=O)[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H62N2O6SSi/c1-12-28-50-39(47)30-38(52-54(10,11)43(7,8)9)36(29-32(2)3)45-40(48)37(46-41(49)51-42(4,5)6)31-53-44(33-22-16-13-17-23-33,34-24-18-14-19-25-34)35-26-20-15-21-27-35/h12-27,32,36-38H,1,28-31H2,2-11H3,(H,45,48)(H,46,49)/t36-,37-,38+/m1/s1 |
| InChIKey | WQZNCMPJDROVDK-IZNNDHRXSA-N |
| XLogP | 9.65 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.14 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|