C24H41NO5Si — CID 11419586
ethyl (3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate (PubChem CID 11419586) has the molecular formula C24H41NO5Si and a molecular weight of 451.68 g/mol. Its IUPAC name is ethyl (3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate.
| Compound Name | ethyl (3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate |
|---|---|
| PubChem CID | 11419586 |
| Molecular Formula | C24H41NO5Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | ethyl (3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate |
| SMILES | CCOC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H41NO5Si/c1-10-28-21(26)17-20(30-31(8,9)24(5,6)7)19(16-18-14-12-11-13-15-18)25-22(27)29-23(2,3)4/h11-15,19-20H,10,16-17H2,1-9H3,(H,25,27)/t19-,20-/m0/s1 |
| InChIKey | JATGUIMDPZXZQM-PMACEKPBSA-N |
| XLogP | 5.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|