C28H42N2O5Si — CID 25198609
ethyl (3R,4S)-4-[(2-aminoacetyl)amino]-3-[tert-butyl(dimethyl)silyl]oxy-5-(4-phenylmethoxyphenyl)pentanoate (PubChem CID 25198609) has the molecular formula C28H42N2O5Si and a molecular weight of 514.74 g/mol. Its IUPAC name is ethyl (3R,4S)-4-[(2-aminoacetyl)amino]-3-[tert-butyl(dimethyl)silyl]oxy-5-(4-phenylmethoxyphenyl)pentanoate.
| Compound Name | ethyl (3R,4S)-4-[(2-aminoacetyl)amino]-3-[tert-butyl(dimethyl)silyl]oxy-5-(4-phenylmethoxyphenyl)pentanoate |
|---|---|
| PubChem CID | 25198609 |
| Molecular Formula | C28H42N2O5Si |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | ethyl (3R,4S)-4-[(2-aminoacetyl)amino]-3-[tert-butyl(dimethyl)silyl]oxy-5-(4-phenylmethoxyphenyl)pentanoate |
| SMILES | CCOC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CN |
| InChI | InChI=1S/C28H42N2O5Si/c1-7-33-27(32)18-25(35-36(5,6)28(2,3)4)24(30-26(31)19-29)17-21-13-15-23(16-14-21)34-20-22-11-9-8-10-12-22/h8-16,24-25H,7,17-20,29H2,1-6H3,(H,30,31)/t24-,25+/m0/s1 |
| InChIKey | FVXHXCHGVNHCPA-LOSJGSFVSA-N |
| XLogP | 4.60 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|