C18H22ClNO3 — CID 171230805
ethyl (3S)-3-amino-3-(4-phenylmethoxyphenyl)propanoate;hydrochloride (PubChem CID 171230805) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(4-phenylmethoxyphenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(4-phenylmethoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171230805 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | ethyl (3S)-3-amino-3-(4-phenylmethoxyphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@H](N)c1ccc(OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C18H21NO3.ClH/c1-2-21-18(20)12-17(19)15-8-10-16(11-9-15)22-13-14-6-4-3-5-7-14;/h3-11,17H,2,12-13,19H2,1H3;1H/t17-;/m0./s1 |
| InChIKey | OPVNUYQSEZRZQP-LMOVPXPDSA-N |
| XLogP | 3.64 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |