C12H18ClNO3 — CID 171246532
methyl (3R)-3-amino-3-(4-ethoxyphenyl)propanoate;hydrochloride (PubChem CID 171246532) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(4-ethoxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(4-ethoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171246532 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | methyl (3R)-3-amino-3-(4-ethoxyphenyl)propanoate;hydrochloride |
| SMILES | CCOc1ccc([C@H](N)CC(=O)OC)cc1.Cl |
| InChI | InChI=1S/C12H17NO3.ClH/c1-3-16-10-6-4-9(5-7-10)11(13)8-12(14)15-2;/h4-7,11H,3,8,13H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | IFWMRGFGPLUOJU-RFVHGSKJSA-N |
| XLogP | 2.07 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |