C11H12F3NO3 — CID 29059481
methyl (3R)-3-amino-3-[4-(trifluoromethoxy)phenyl]propanoate (PubChem CID 29059481) has the molecular formula C11H12F3NO3 and a molecular weight of 263.22 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-[4-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | methyl (3R)-3-amino-3-[4-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 29059481 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | methyl (3R)-3-amino-3-[4-(trifluoromethoxy)phenyl]propanoate |
| SMILES | COC(=O)C[C@@H](N)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO3/c1-17-10(16)6-9(15)7-2-4-8(5-3-7)18-11(12,13)14/h2-5,9H,6,15H2,1H3/t9-/m1/s1 |
| InChIKey | NEFHCFFUOYZWKJ-SECBINFHSA-N |
| XLogP | 2.15 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |