C10H11ClF3NO3 — CID 68701714
methyl 2-amino-2-[4-(trifluoromethoxy)phenyl]acetate;hydrochloride (PubChem CID 68701714) has the molecular formula C10H11ClF3NO3 and a molecular weight of 285.65 g/mol. Its IUPAC name is methyl 2-amino-2-[4-(trifluoromethoxy)phenyl]acetate;hydrochloride.
| Compound Name | methyl 2-amino-2-[4-(trifluoromethoxy)phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 68701714 |
| Molecular Formula | C10H11ClF3NO3 |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | methyl 2-amino-2-[4-(trifluoromethoxy)phenyl]acetate;hydrochloride |
| SMILES | COC(=O)C(N)c1ccc(OC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C10H10F3NO3.ClH/c1-16-9(15)8(14)6-2-4-7(5-3-6)17-10(11,12)13;/h2-5,8H,14H2,1H3;1H |
| InChIKey | AKUKLRZJSVKAOF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |