C19H19F6N3O5 — CID 87637820
methyl 2-amino-2-[4-(trifluoromethoxy)phenyl]acetate;N,N,2-trideuterio-2-(deuterioamino)-2-[2,3,5,6-tetradeuterio-4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 87637820) has the molecular formula C19H19F6N3O5 and a molecular weight of 491.41 g/mol. Its IUPAC name is methyl 2-amino-2-[4-(trifluoromethoxy)phenyl]acetate;N,N,2-trideuterio-2-(deuterioamino)-2-[2,3,5,6-tetradeuterio-4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | methyl 2-amino-2-[4-(trifluoromethoxy)phenyl]acetate;N,N,2-trideuterio-2-(deuterioamino)-2-[2,3,5,6-tetradeuterio-4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 87637820 |
| Molecular Formula | C19H19F6N3O5 |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | methyl 2-amino-2-[4-(trifluoromethoxy)phenyl]acetate;N,N,2-trideuterio-2-(deuterioamino)-2-[2,3,5,6-tetradeuterio-4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COC(=O)C(N)c1ccc(OC(F)(F)F)cc1.[2H]NC([2H])(C(=O)N([2H])[2H])c1c([2H])c([2H])c(OC(F)(F)F)c([2H])c1[2H] |
| InChI | InChI=1S/C10H10F3NO3.C9H9F3N2O2/c1-16-9(15)8(14)6-2-4-7(5-3-6)17-10(11,12)13;10-9(11,12)16-6-3-1-5(2-4-6)7(13)8(14)15/h2-5,8H,14H2,1H3;1-4,7H,13H2,(H2,14,15)/i;1D,2D,3D,4D,7D/hD3 |
| InChIKey | NXMMHMPVKCHJNC-ZQNOPNTKSA-N |
| XLogP | 2.83 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |