C10H10Cl2F3NO3 — CID 171208232
methyl (2S)-2-amino-2-[3-chloro-4-(trifluoromethoxy)phenyl]acetate;hydrochloride (PubChem CID 171208232) has the molecular formula C10H10Cl2F3NO3 and a molecular weight of 320.09 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[3-chloro-4-(trifluoromethoxy)phenyl]acetate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-2-[3-chloro-4-(trifluoromethoxy)phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 171208232 |
| Molecular Formula | C10H10Cl2F3NO3 |
| Molecular Weight | 320.09 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | methyl (2S)-2-amino-2-[3-chloro-4-(trifluoromethoxy)phenyl]acetate;hydrochloride |
| SMILES | COC(=O)[C@@H](N)c1ccc(OC(F)(F)F)c(Cl)c1.Cl |
| InChI | InChI=1S/C10H9ClF3NO3.ClH/c1-17-9(16)8(15)5-2-3-7(6(11)4-5)18-10(12,13)14;/h2-4,8H,15H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | WFMOOFUTZYOAKR-QRPNPIFTSA-N |
| XLogP | 2.83 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.09 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |