C10H7Cl2F8NO — CID 171311761
(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride (PubChem CID 171311761) has the molecular formula C10H7Cl2F8NO and a molecular weight of 380.06 g/mol. Its IUPAC name is (1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride.
| Compound Name | (1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171311761 |
| Molecular Formula | C10H7Cl2F8NO |
| Molecular Weight | 380.06 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | (1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(OC(F)(F)F)c(Cl)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6ClF8NO.ClH/c11-5-3-4(1-2-6(5)21-10(17,18)19)7(20)8(12,13)9(14,15)16;/h1-3,7H,20H2;1H/t7-;/m0./s1 |
| InChIKey | BHLVTBZVNYNDFL-FJXQXJEOSA-N |
| XLogP | 4.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.06 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|