C12H17Cl2F3N2O — CID 171208195
(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride (PubChem CID 171208195) has the molecular formula C12H17Cl2F3N2O and a molecular weight of 333.18 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171208195 |
| Molecular Formula | C12H17Cl2F3N2O |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClF3N2O.ClH/c13-9-7-8(10(18)3-1-2-6-17)4-5-11(9)19-12(14,15)16;/h4-5,7,10H,1-3,6,17-18H2;1H/t10-;/m1./s1 |
| InChIKey | OHRLVRIMQLUTJZ-HNCPQSOCSA-N |
| XLogP | 3.79 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|