C11H11F4NO3 — CID 171228282
methyl (2R)-2-amino-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]acetate (PubChem CID 171228282) has the molecular formula C11H11F4NO3 and a molecular weight of 281.20 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]acetate.
| Compound Name | methyl (2R)-2-amino-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 171228282 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | methyl (2R)-2-amino-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]acetate |
| SMILES | COC(=O)[C@H](N)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H11F4NO3/c1-18-9(17)8(16)6-2-4-7(5-3-6)19-11(14,15)10(12)13/h2-5,8,10H,16H2,1H3/t8-/m1/s1 |
| InChIKey | DUOLIOZOBYLMTR-MRVPVSSYSA-N |
| XLogP | 2.10 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|