C13H18ClF4NO2 — CID 171249266
(3S)-3-amino-2,2-dimethyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-ol;hydrochloride (PubChem CID 171249266) has the molecular formula C13H18ClF4NO2 and a molecular weight of 331.74 g/mol. Its IUPAC name is (3S)-3-amino-2,2-dimethyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-ol;hydrochloride.
| Compound Name | (3S)-3-amino-2,2-dimethyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171249266 |
| Molecular Formula | C13H18ClF4NO2 |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (3S)-3-amino-2,2-dimethyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-ol;hydrochloride |
| SMILES | CC(C)(CO)[C@@H](N)c1ccc(OC(F)(F)C(F)F)cc1.Cl |
| InChI | InChI=1S/C13H17F4NO2.ClH/c1-12(2,7-19)10(18)8-3-5-9(6-4-8)20-13(16,17)11(14)15;/h3-6,10-11,19H,7,18H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | DETZPNUNJWGSNT-PPHPATTJSA-N |
| XLogP | 3.36 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|