C13H16ClF4NO — CID 171228277
(1S)-3-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]but-3-en-1-amine;hydrochloride (PubChem CID 171228277) has the molecular formula C13H16ClF4NO and a molecular weight of 313.72 g/mol. Its IUPAC name is (1S)-3-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]but-3-en-1-amine;hydrochloride.
| Compound Name | (1S)-3-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171228277 |
| Molecular Formula | C13H16ClF4NO |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (1S)-3-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]but-3-en-1-amine;hydrochloride |
| SMILES | C=C(C)C[C@H](N)c1ccc(OC(F)(F)C(F)F)cc1.Cl |
| InChI | InChI=1S/C13H15F4NO.ClH/c1-8(2)7-11(18)9-3-5-10(6-4-9)19-13(16,17)12(14)15;/h3-6,11-12H,1,7,18H2,2H3;1H/t11-;/m0./s1 |
| InChIKey | KHEXXPCVTMFPFF-MERQFXBCSA-N |
| XLogP | 4.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|