C16H14F3NO2 — CID 171211560
methyl (2S)-2-amino-2-[4-[4-(trifluoromethyl)phenyl]phenyl]acetate (PubChem CID 171211560) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[4-[4-(trifluoromethyl)phenyl]phenyl]acetate.
| Compound Name | methyl (2S)-2-amino-2-[4-[4-(trifluoromethyl)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 171211560 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl (2S)-2-amino-2-[4-[4-(trifluoromethyl)phenyl]phenyl]acetate |
| SMILES | COC(=O)[C@@H](N)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H14F3NO2/c1-22-15(21)14(20)12-4-2-10(3-5-12)11-6-8-13(9-7-11)16(17,18)19/h2-9,14H,20H2,1H3/t14-/m0/s1 |
| InChIKey | MDENBFFHTQHAMU-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |