C15H14F3NO3 — CID 170884286
methyl 2-amino-3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]propanoate (PubChem CID 170884286) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is methyl 2-amino-3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]propanoate.
| Compound Name | methyl 2-amino-3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]propanoate |
|---|---|
| PubChem CID | 170884286 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | methyl 2-amino-3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(-c2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C15H14F3NO3/c1-21-14(20)12(19)8-11-6-7-13(22-11)9-2-4-10(5-3-9)15(16,17)18/h2-7,12H,8,19H2,1H3 |
| InChIKey | MEDQLJGVGPVGAY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |