C18H21F3N2O3 — CID 120987274
2-amino-N-ethyl-3-methoxy-N-[[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methyl]propanamide (PubChem CID 120987274) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 2-amino-N-ethyl-3-methoxy-N-[[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methyl]propanamide.
| Compound Name | 2-amino-N-ethyl-3-methoxy-N-[[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 120987274 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-amino-N-ethyl-3-methoxy-N-[[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methyl]propanamide |
| SMILES | CCN(Cc1ccc(-c2ccc(C(F)(F)F)cc2)o1)C(=O)C(N)COC |
| InChI | InChI=1S/C18H21F3N2O3/c1-3-23(17(24)15(22)11-25-2)10-14-8-9-16(26-14)12-4-6-13(7-5-12)18(19,20)21/h4-9,15H,3,10-11,22H2,1-2H3 |
| InChIKey | XQODYIYAADUOGW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |