C14H18FN3O2 — CID 81083579
2-amino-N-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-3-methoxypropanamide (PubChem CID 81083579) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-amino-N-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-3-methoxypropanamide.
| Compound Name | 2-amino-N-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-3-methoxypropanamide |
|---|---|
| PubChem CID | 81083579 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-amino-N-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-3-methoxypropanamide |
| SMILES | CCN(Cc1ccc(C#N)cc1F)C(=O)C(N)COC |
| InChI | InChI=1S/C14H18FN3O2/c1-3-18(14(19)13(17)9-20-2)8-11-5-4-10(7-16)6-12(11)15/h4-6,13H,3,8-9,17H2,1-2H3 |
| InChIKey | LSHMGQFTNGPYOX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |