C15H20FN3O2 — CID 79272052
N-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-2-(2-methoxyethylamino)acetamide (PubChem CID 79272052) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is N-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 79272052 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-2-(2-methoxyethylamino)acetamide |
| SMILES | CCN(Cc1ccc(C#N)cc1F)C(=O)CNCCOC |
| InChI | InChI=1S/C15H20FN3O2/c1-3-19(15(20)10-18-6-7-21-2)11-13-5-4-12(9-17)8-14(13)16/h4-5,8,18H,3,6-7,10-11H2,1-2H3 |
| InChIKey | IVACVFGNZXLXCR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|