C15H21FN2O — CID 54942311
4-[[butan-2-yl(2-methoxyethyl)amino]methyl]-3-fluorobenzonitrile (PubChem CID 54942311) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is 4-[[butan-2-yl(2-methoxyethyl)amino]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[butan-2-yl(2-methoxyethyl)amino]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 54942311 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4-[[butan-2-yl(2-methoxyethyl)amino]methyl]-3-fluorobenzonitrile |
| SMILES | CCC(C)N(CCOC)Cc1ccc(C#N)cc1F |
| InChI | InChI=1S/C15H21FN2O/c1-4-12(2)18(7-8-19-3)11-14-6-5-13(10-17)9-15(14)16/h5-6,9,12H,4,7-8,11H2,1-3H3 |
| InChIKey | QNZRSYVSKIDMPX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |