C16H23FN2 — CID 60969380
4-[[ethyl(2-ethylbutyl)amino]methyl]-3-fluorobenzonitrile (PubChem CID 60969380) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is 4-[[ethyl(2-ethylbutyl)amino]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[ethyl(2-ethylbutyl)amino]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 60969380 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-[[ethyl(2-ethylbutyl)amino]methyl]-3-fluorobenzonitrile |
| SMILES | CCC(CC)CN(CC)Cc1ccc(C#N)cc1F |
| InChI | InChI=1S/C16H23FN2/c1-4-13(5-2)11-19(6-3)12-15-8-7-14(10-18)9-16(15)17/h7-9,13H,4-6,11-12H2,1-3H3 |
| InChIKey | BGALIBPCBVJLNZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |