C13H15FN2 — CID 47038993
4-[[ethyl(prop-2-enyl)amino]methyl]-3-fluorobenzonitrile (PubChem CID 47038993) has the molecular formula C13H15FN2 and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-[[ethyl(prop-2-enyl)amino]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[ethyl(prop-2-enyl)amino]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 47038993 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-[[ethyl(prop-2-enyl)amino]methyl]-3-fluorobenzonitrile |
| SMILES | C=CCN(CC)Cc1ccc(C#N)cc1F |
| InChI | InChI=1S/C13H15FN2/c1-3-7-16(4-2)10-12-6-5-11(9-15)8-13(12)14/h3,5-6,8H,1,4,7,10H2,2H3 |
| InChIKey | SXJNVYSGEMMRHF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|