C15H17FN2O2 — CID 78977896
ethyl 2-[(5-cyano-2-fluorophenyl)methyl-prop-2-enylamino]acetate (PubChem CID 78977896) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is ethyl 2-[(5-cyano-2-fluorophenyl)methyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(5-cyano-2-fluorophenyl)methyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 78977896 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | ethyl 2-[(5-cyano-2-fluorophenyl)methyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)Cc1cc(C#N)ccc1F |
| InChI | InChI=1S/C15H17FN2O2/c1-3-7-18(11-15(19)20-4-2)10-13-8-12(9-17)5-6-14(13)16/h3,5-6,8H,1,4,7,10-11H2,2H3 |
| InChIKey | ZWQHIDLRZDEVKE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|