C14H17ClN2O4 — CID 115539172
ethyl 2-[(2-chloro-4-nitrophenyl)methyl-prop-2-enylamino]acetate (PubChem CID 115539172) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-4-nitrophenyl)methyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(2-chloro-4-nitrophenyl)methyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 115539172 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | ethyl 2-[(2-chloro-4-nitrophenyl)methyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)Cc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H17ClN2O4/c1-3-7-16(10-14(18)21-4-2)9-11-5-6-12(17(19)20)8-13(11)15/h3,5-6,8H,1,4,7,9-10H2,2H3 |
| InChIKey | INGVMMYQTFLDEA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|