C14H17BrClNO2 — CID 113228495
ethyl 2-[(4-bromo-2-chlorophenyl)methyl-prop-2-enylamino]acetate (PubChem CID 113228495) has the molecular formula C14H17BrClNO2 and a molecular weight of 346.65 g/mol. Its IUPAC name is ethyl 2-[(4-bromo-2-chlorophenyl)methyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(4-bromo-2-chlorophenyl)methyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 113228495 |
| Molecular Formula | C14H17BrClNO2 |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | ethyl 2-[(4-bromo-2-chlorophenyl)methyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H17BrClNO2/c1-3-7-17(10-14(18)19-4-2)9-11-5-6-12(15)8-13(11)16/h3,5-6,8H,1,4,7,9-10H2,2H3 |
| InChIKey | MDVIZOHLGBWOOM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|