C14H17ClFNO2 — CID 112550232
ethyl 2-[(2-chloro-3-fluorophenyl)methyl-prop-2-enylamino]acetate (PubChem CID 112550232) has the molecular formula C14H17ClFNO2 and a molecular weight of 285.75 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-3-fluorophenyl)methyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(2-chloro-3-fluorophenyl)methyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 112550232 |
| Molecular Formula | C14H17ClFNO2 |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | ethyl 2-[(2-chloro-3-fluorophenyl)methyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C14H17ClFNO2/c1-3-8-17(10-13(18)19-4-2)9-11-6-5-7-12(16)14(11)15/h3,5-7H,1,4,8-10H2,2H3 |
| InChIKey | LHELUANHMDKKEG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|