C12H16BrNO2S — CID 78977546
ethyl 2-[(3-bromothiophen-2-yl)methyl-prop-2-enylamino]acetate (PubChem CID 78977546) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is ethyl 2-[(3-bromothiophen-2-yl)methyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(3-bromothiophen-2-yl)methyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 78977546 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | ethyl 2-[(3-bromothiophen-2-yl)methyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)Cc1sccc1Br |
| InChI | InChI=1S/C12H16BrNO2S/c1-3-6-14(9-12(15)16-4-2)8-11-10(13)5-7-17-11/h3,5,7H,1,4,6,8-9H2,2H3 |
| InChIKey | RDOHNAFYNGCIAM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|