C11H16N2O2S — CID 78925765
ethyl 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]acetate (PubChem CID 78925765) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is ethyl 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]acetate.
| Compound Name | ethyl 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]acetate |
|---|---|
| PubChem CID | 78925765 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | ethyl 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]acetate |
| SMILES | C=CCN(CC(=O)OCC)Cc1cscn1 |
| InChI | InChI=1S/C11H16N2O2S/c1-3-5-13(7-11(14)15-4-2)6-10-8-16-9-12-10/h3,8-9H,1,4-7H2,2H3 |
| InChIKey | MRRXSRVNPPSVHL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|