About ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate
ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate (PubChem CID 78979130) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate |
| PubChem CID | 78979130 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)Cc1nnc(CC)o1 |
| InChI | InChI=1S/C12H19N3O3/c1-4-7-15(9-12(16)17-6-3)8-11-14-13-10(5-2)18-11/h4H,1,5-9H2,2-3H3 |
| InChIKey | SQLFEXWPLIPNJY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate?
The IUPAC name of ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate (CID 78979130) is ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate.
What is the SMILES notation for ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate?
The canonical SMILES for ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate is C=CCN(CC(=O)OCC)Cc1nnc(CC)o1.
What is the InChIKey of ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate?
The InChIKey is SQLFEXWPLIPNJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-4-7-15(9-12(16)17-6-3)8-11-14-13-10(5-2)18-11/h4H,1,5-9H2,2-3H3.
What are the key properties of ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate?
ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate has a molecular weight of 253.30 g/mol, XLogP of 1.18, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl-prop-2-enylamino]acetate is sourced from PubChem (CID 78979130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).