C11H18N6O2 — CID 79047847
ethyl 2-[(4,6-diamino-1,3,5-triazin-2-yl)methyl-prop-2-enylamino]acetate (PubChem CID 79047847) has the molecular formula C11H18N6O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is ethyl 2-[(4,6-diamino-1,3,5-triazin-2-yl)methyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(4,6-diamino-1,3,5-triazin-2-yl)methyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 79047847 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | ethyl 2-[(4,6-diamino-1,3,5-triazin-2-yl)methyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)Cc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C11H18N6O2/c1-3-5-17(7-9(18)19-4-2)6-8-14-10(12)16-11(13)15-8/h3H,1,4-7H2,2H3,(H4,12,13,14,15,16) |
| InChIKey | IMJAPQUHBMYBAD-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|