C11H18N2O2S — CID 64662480
ethyl 2-[methyl(1,3-thiazol-4-ylmethyl)amino]butanoate (PubChem CID 64662480) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is ethyl 2-[methyl(1,3-thiazol-4-ylmethyl)amino]butanoate.
| Compound Name | ethyl 2-[methyl(1,3-thiazol-4-ylmethyl)amino]butanoate |
|---|---|
| PubChem CID | 64662480 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethyl 2-[methyl(1,3-thiazol-4-ylmethyl)amino]butanoate |
| SMILES | CCOC(=O)C(CC)N(C)Cc1cscn1 |
| InChI | InChI=1S/C11H18N2O2S/c1-4-10(11(14)15-5-2)13(3)6-9-7-16-8-12-9/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | UCYKXRZAHNPMET-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |