About 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate
2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate (PubChem CID 79349772) has the molecular formula C8H12N2O3S
and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate.
Analyze 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate?
The IUPAC name of 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate (CID 79349772) is 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate.
What is the SMILES notation for 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate?
The canonical SMILES for 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate is CN(Cc1cscn1)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate?
The InChIKey is HSEXNVATNXPHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3S/c1-10(8(12)13-3-2-11)4-7-5-14-6-9-7/h5-6,11H,2-4H2,1H3.
What are the key properties of 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate?
2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate has a molecular weight of 216.26 g/mol, XLogP of 0.70, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-methyl-N-(1,3-thiazol-4-ylmethyl)carbamate is sourced from PubChem (CID 79349772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).