C8H7F5N2OS — CID 114038182
2,2,3,3,3-pentafluoro-N-methyl-N-(1,3-thiazol-4-ylmethyl)propanamide (PubChem CID 114038182) has the molecular formula C8H7F5N2OS and a molecular weight of 274.21 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-methyl-N-(1,3-thiazol-4-ylmethyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-methyl-N-(1,3-thiazol-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 114038182 |
| Molecular Formula | C8H7F5N2OS |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-methyl-N-(1,3-thiazol-4-ylmethyl)propanamide |
| SMILES | CN(Cc1cscn1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F5N2OS/c1-15(2-5-3-17-4-14-5)6(16)7(9,10)8(11,12)13/h3-4H,2H2,1H3 |
| InChIKey | NQJGCPMRZNMTLY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|