C10H17N3OS — CID 107569472
(2S)-2-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide (PubChem CID 107569472) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is (2S)-2-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide.
| Compound Name | (2S)-2-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 107569472 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2S)-2-amino-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide |
| SMILES | CCC[C@H](N)C(=O)N(C)Cc1cscn1 |
| InChI | InChI=1S/C10H17N3OS/c1-3-4-9(11)10(14)13(2)5-8-6-15-7-12-8/h6-7,9H,3-5,11H2,1-2H3/t9-/m0/s1 |
| InChIKey | JRXOTIOKQUQTSW-VIFPVBQESA-N |
| XLogP | 1.23 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |