C14H27N3S — CID 55013958
2-N-methyl-2-N-(1,3-thiazol-4-ylmethyl)nonane-1,2-diamine (PubChem CID 55013958) has the molecular formula C14H27N3S and a molecular weight of 269.46 g/mol. Its IUPAC name is 2-N-methyl-2-N-(1,3-thiazol-4-ylmethyl)nonane-1,2-diamine.
| Compound Name | 2-N-methyl-2-N-(1,3-thiazol-4-ylmethyl)nonane-1,2-diamine |
|---|---|
| PubChem CID | 55013958 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-N-methyl-2-N-(1,3-thiazol-4-ylmethyl)nonane-1,2-diamine |
| SMILES | CCCCCCCC(CN)N(C)Cc1cscn1 |
| InChI | InChI=1S/C14H27N3S/c1-3-4-5-6-7-8-14(9-15)17(2)10-13-11-18-12-16-13/h11-12,14H,3-10,15H2,1-2H3 |
| InChIKey | XLIAXEFRANKBKP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|