methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate

C10H16N2O2S — CID 62012526

IUPACmethyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate
SMILESCCCN(CC(=O)OC)Cc1cscn1
InChIInChI=1S/C10H16N2O2S/c1-3-4-12(6-10(13)14-2)5-9-7-15-8-11-9/h7-8H,3-6H2,1-2H3
InChIKeyUUKFZAXBVGCBEX-UHFFFAOYSA-N
MW228.32 g/mol
LogP1.53
Rot. Bonds6

About methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate

methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate (PubChem CID 62012526) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate
PubChem CID62012526
Molecular FormulaC10H16N2O2S
Molecular Weight228.32 g/mol
Exact Mass228.09
IUPAC Namemethyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate
SMILESCCCN(CC(=O)OC)Cc1cscn1
InChIInChI=1S/C10H16N2O2S/c1-3-4-12(6-10(13)14-2)5-9-7-15-8-11-9/h7-8H,3-6H2,1-2H3
InChIKeyUUKFZAXBVGCBEX-UHFFFAOYSA-N
XLogP1.53
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.32
LogP ≤ 51.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate?
The IUPAC name of methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate (CID 62012526) is methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate.
What is the SMILES notation for methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate?
The canonical SMILES for methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate is CCCN(CC(=O)OC)Cc1cscn1.
What is the InChIKey of methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate?
The InChIKey is UUKFZAXBVGCBEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-3-4-12(6-10(13)14-2)5-9-7-15-8-11-9/h7-8H,3-6H2,1-2H3.
What are the key properties of methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate?
methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate has a molecular weight of 228.32 g/mol, XLogP of 1.53, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate is sourced from PubChem (CID 62012526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).