C10H16N2O2S — CID 62012526
methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate (PubChem CID 62012526) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate.
| Compound Name | methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate |
|---|---|
| PubChem CID | 62012526 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | methyl 2-[propyl(1,3-thiazol-4-ylmethyl)amino]acetate |
| SMILES | CCCN(CC(=O)OC)Cc1cscn1 |
| InChI | InChI=1S/C10H16N2O2S/c1-3-4-12(6-10(13)14-2)5-9-7-15-8-11-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | UUKFZAXBVGCBEX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |