2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid

C10H16N2O2S — CID 60833411

IUPAC2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid
SMILESCCC(C)N(CC(=O)O)Cc1cscn1
InChIInChI=1S/C10H16N2O2S/c1-3-8(2)12(5-10(13)14)4-9-6-15-7-11-9/h6-8H,3-5H2,1-2H3,(H,13,14)
InChIKeySYVPCXUUCRSBNG-UHFFFAOYSA-N
MW228.32 g/mol
LogP1.83
Rot. Bonds6

About 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid

2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid (PubChem CID 60833411) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid
PubChem CID60833411
Molecular FormulaC10H16N2O2S
Molecular Weight228.32 g/mol
Exact Mass228.09
IUPAC Name2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid
SMILESCCC(C)N(CC(=O)O)Cc1cscn1
InChIInChI=1S/C10H16N2O2S/c1-3-8(2)12(5-10(13)14)4-9-6-15-7-11-9/h6-8H,3-5H2,1-2H3,(H,13,14)
InChIKeySYVPCXUUCRSBNG-UHFFFAOYSA-N
XLogP1.83
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.32
LogP ≤ 51.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid?
The IUPAC name of 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid (CID 60833411) is 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid.
What is the SMILES notation for 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid?
The canonical SMILES for 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid is CCC(C)N(CC(=O)O)Cc1cscn1.
What is the InChIKey of 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid?
The InChIKey is SYVPCXUUCRSBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-3-8(2)12(5-10(13)14)4-9-6-15-7-11-9/h6-8H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid?
2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid has a molecular weight of 228.32 g/mol, XLogP of 1.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butan-2-yl(1,3-thiazol-4-ylmethyl)amino]acetic acid is sourced from PubChem (CID 60833411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).