C10H12BrNO2S — CID 79276316
2-[(3-bromothiophen-2-yl)methyl-prop-2-enylamino]acetic acid (PubChem CID 79276316) has the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)methyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(3-bromothiophen-2-yl)methyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79276316 |
| Molecular Formula | C10H12BrNO2S |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)methyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)Cc1sccc1Br |
| InChI | InChI=1S/C10H12BrNO2S/c1-2-4-12(7-10(13)14)6-9-8(11)3-5-15-9/h2-3,5H,1,4,6-7H2,(H,13,14) |
| InChIKey | PWXGIMPDHLQYSF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|