C10H14N2O2S — CID 166291479
2-[(4-methyl-1,2-thiazol-5-yl)methyl-prop-2-enylamino]acetic acid (PubChem CID 166291479) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-[(4-methyl-1,2-thiazol-5-yl)methyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(4-methyl-1,2-thiazol-5-yl)methyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 166291479 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-[(4-methyl-1,2-thiazol-5-yl)methyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)Cc1sncc1C |
| InChI | InChI=1S/C10H14N2O2S/c1-3-4-12(7-10(13)14)6-9-8(2)5-11-15-9/h3,5H,1,4,6-7H2,2H3,(H,13,14) |
| InChIKey | FEUAWIFNKSTUCS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|