C11H15N3O2 — CID 115529713
2-[(2-methylpyrimidin-4-yl)methyl-prop-2-enylamino]acetic acid (PubChem CID 115529713) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-[(2-methylpyrimidin-4-yl)methyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(2-methylpyrimidin-4-yl)methyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 115529713 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-[(2-methylpyrimidin-4-yl)methyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)Cc1ccnc(C)n1 |
| InChI | InChI=1S/C11H15N3O2/c1-3-6-14(8-11(15)16)7-10-4-5-12-9(2)13-10/h3-5H,1,6-8H2,2H3,(H,15,16) |
| InChIKey | GXJRSUKGESDLFI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|