C14H19ClFNO2 — CID 114857982
ethyl 2-[(4-chloro-2-fluorophenyl)methyl-propylamino]acetate (PubChem CID 114857982) has the molecular formula C14H19ClFNO2 and a molecular weight of 287.76 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-2-fluorophenyl)methyl-propylamino]acetate.
| Compound Name | ethyl 2-[(4-chloro-2-fluorophenyl)methyl-propylamino]acetate |
|---|---|
| PubChem CID | 114857982 |
| Molecular Formula | C14H19ClFNO2 |
| Molecular Weight | 287.76 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | ethyl 2-[(4-chloro-2-fluorophenyl)methyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OCC)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H19ClFNO2/c1-3-7-17(10-14(18)19-4-2)9-11-5-6-12(15)8-13(11)16/h5-6,8H,3-4,7,9-10H2,1-2H3 |
| InChIKey | KMDGWFHOJVGNOZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.76 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |